C11H13NO3S — CID 116932296
2-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)acetamide (PubChem CID 116932296) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)acetamide.
| Compound Name | 2-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 116932296 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)acetamide |
| SMILES | NC(=O)Cc1ccc2c(c1)CCCS2(=O)=O |
| InChI | InChI=1S/C11H13NO3S/c12-11(13)7-8-3-4-10-9(6-8)2-1-5-16(10,14)15/h3-4,6H,1-2,5,7H2,(H2,12,13) |
| InChIKey | SZIBIQYZPSJXTF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |