C7H16N2 — CID 116932568
1-cyclobutylpropane-1,2-diamine (PubChem CID 116932568) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-cyclobutylpropane-1,2-diamine.
| Compound Name | 1-cyclobutylpropane-1,2-diamine |
|---|---|
| PubChem CID | 116932568 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-cyclobutylpropane-1,2-diamine |
| SMILES | CC(N)C(N)C1CCC1 |
| InChI | InChI=1S/C7H16N2/c1-5(8)7(9)6-3-2-4-6/h5-7H,2-4,8-9H2,1H3 |
| InChIKey | ZSFRLEOQQPJYCG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |