C18H34N2 — CID 141199870
1,4-bis(1-cyclobutylethyl)cyclohexane-1,4-diamine (PubChem CID 141199870) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1,4-bis(1-cyclobutylethyl)cyclohexane-1,4-diamine.
| Compound Name | 1,4-bis(1-cyclobutylethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 141199870 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1,4-bis(1-cyclobutylethyl)cyclohexane-1,4-diamine |
| SMILES | CC(C1CCC1)C1(N)CCC(N)(C(C)C2CCC2)CC1 |
| InChI | InChI=1S/C18H34N2/c1-13(15-5-3-6-15)17(19)9-11-18(20,12-10-17)14(2)16-7-4-8-16/h13-16H,3-12,19-20H2,1-2H3 |
| InChIKey | QXJCZPHYOUBOPC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |