C8H18N2O — CID 116932858
1-(oxan-4-yl)propane-1,3-diamine (PubChem CID 116932858) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | 1-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116932858 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1-(oxan-4-yl)propane-1,3-diamine |
| SMILES | NCCC(N)C1CCOCC1 |
| InChI | InChI=1S/C8H18N2O/c9-4-1-8(10)7-2-5-11-6-3-7/h7-8H,1-6,9-10H2 |
| InChIKey | FTUSUNLNOISOIF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |