C10H20N2O — CID 117238528
N'-cyclopropyl-1-(oxan-4-yl)ethane-1,2-diamine (PubChem CID 117238528) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N'-cyclopropyl-1-(oxan-4-yl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-1-(oxan-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 117238528 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N'-cyclopropyl-1-(oxan-4-yl)ethane-1,2-diamine |
| SMILES | NC(CNC1CC1)C1CCOCC1 |
| InChI | InChI=1S/C10H20N2O/c11-10(7-12-9-1-2-9)8-3-5-13-6-4-8/h8-10,12H,1-7,11H2 |
| InChIKey | KSAIUFRMJQOSAA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |