N-(2-methylpropyl)oxan-4-amine;molecular hydrogen

C9H21NO — CID 156813143

IUPACN-(2-methylpropyl)oxan-4-amine;molecular hydrogen
SMILESCC(C)CNC1CCOCC1.[H][H]
InChIInChI=1S/C9H19NO.H2/c1-8(2)7-10-9-3-5-11-6-4-9;/h8-10H,3-7H2,1-2H3;1H
InChIKeyIYHXOUAYVNSFGT-UHFFFAOYSA-N
MW159.27 g/mol
LogP1.66
Rot. Bonds3

About N-(2-methylpropyl)oxan-4-amine;molecular hydrogen

N-(2-methylpropyl)oxan-4-amine;molecular hydrogen (PubChem CID 156813143) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is N-(2-methylpropyl)oxan-4-amine;molecular hydrogen.

Molecular Properties

Compound NameN-(2-methylpropyl)oxan-4-amine;molecular hydrogen
PubChem CID156813143
Molecular FormulaC9H21NO
Molecular Weight159.27 g/mol
Exact Mass159.16
IUPAC NameN-(2-methylpropyl)oxan-4-amine;molecular hydrogen
SMILESCC(C)CNC1CCOCC1.[H][H]
InChIInChI=1S/C9H19NO.H2/c1-8(2)7-10-9-3-5-11-6-4-9;/h8-10H,3-7H2,1-2H3;1H
InChIKeyIYHXOUAYVNSFGT-UHFFFAOYSA-N
XLogP1.66
TPSA21.26 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.27
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-(2-methylpropyl)oxan-4-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-methylpropyl)oxan-4-amine;molecular hydrogen?
The IUPAC name of N-(2-methylpropyl)oxan-4-amine;molecular hydrogen (CID 156813143) is N-(2-methylpropyl)oxan-4-amine;molecular hydrogen.
What is the SMILES notation for N-(2-methylpropyl)oxan-4-amine;molecular hydrogen?
The canonical SMILES for N-(2-methylpropyl)oxan-4-amine;molecular hydrogen is CC(C)CNC1CCOCC1.[H][H].
What is the InChIKey of N-(2-methylpropyl)oxan-4-amine;molecular hydrogen?
The InChIKey is IYHXOUAYVNSFGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.H2/c1-8(2)7-10-9-3-5-11-6-4-9;/h8-10H,3-7H2,1-2H3;1H.
What are the key properties of N-(2-methylpropyl)oxan-4-amine;molecular hydrogen?
N-(2-methylpropyl)oxan-4-amine;molecular hydrogen has a molecular weight of 159.27 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)oxan-4-amine;molecular hydrogen is sourced from PubChem (CID 156813143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).