About N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine
N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine (PubChem CID 158109886) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine.
Molecular Properties
| Compound Name | N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine |
| PubChem CID | 158109886 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine |
| SMILES | CC(C)N(C)CNC1CCOCC1 |
| InChI | InChI=1S/C10H22N2O/c1-9(2)12(3)8-11-10-4-6-13-7-5-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | FEORQNKHEHXXQN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine?
The IUPAC name of N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine (CID 158109886) is N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine.
What is the SMILES notation for N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine?
The canonical SMILES for N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine is CC(C)N(C)CNC1CCOCC1.
What is the InChIKey of N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine?
The InChIKey is FEORQNKHEHXXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-9(2)12(3)8-11-10-4-6-13-7-5-10/h9-11H,4-8H2,1-3H3.
What are the key properties of N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine?
N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine has a molecular weight of 186.30 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-(oxan-4-yl)-N'-propan-2-ylmethanediamine is sourced from PubChem (CID 158109886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).