C45H47NO6 — CID 11693288
benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-3,4-bis(phenylmethoxy)-5-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 11693288) has the molecular formula C45H47NO6 and a molecular weight of 697.87 g/mol. Its IUPAC name is benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-3,4-bis(phenylmethoxy)-5-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-3,4-bis(phenylmethoxy)-5-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11693288 |
| Molecular Formula | C45H47NO6 |
| Molecular Weight | 697.87 g/mol |
| Exact Mass | 697.34 |
| IUPAC Name | benzyl (2S,3S,4S,5R)-2-[(1S)-1,2-bis(phenylmethoxy)ethyl]-3,4-bis(phenylmethoxy)-5-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]([C@@H](COCc2ccccc2)OCc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H47NO6/c1-2-18-40-43(50-31-37-23-12-5-13-24-37)44(51-32-38-25-14-6-15-26-38)42(46(40)45(47)52-33-39-27-16-7-17-28-39)41(49-30-36-21-10-4-11-22-36)34-48-29-35-19-8-3-9-20-35/h2-17,19-28,40-44H,1,18,29-34H2/t40-,41-,42+,43+,44+/m1/s1 |
| InChIKey | IFMRVOXATHTBSL-JGWPTPRHSA-N |
| XLogP | 8.93 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.87 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|