C12H16BrNO2S — CID 116938801
4-[amino-(5-bromothiophen-2-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 116938801) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-[amino-(5-bromothiophen-2-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[amino-(5-bromothiophen-2-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 116938801 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-[amino-(5-bromothiophen-2-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | NC(c1ccc(Br)s1)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H16BrNO2S/c13-10-6-5-9(17-10)11(14)7-1-3-8(4-2-7)12(15)16/h5-8,11H,1-4,14H2,(H,15,16) |
| InChIKey | KPUJPUKISMKNFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |