C13H17N3O3 — CID 116941185
6-[amino(morpholin-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116941185) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-[amino(morpholin-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[amino(morpholin-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116941185 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-[amino(morpholin-3-yl)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(N)C3COCCN3)ccc21 |
| InChI | InChI=1S/C13H17N3O3/c1-16-10-3-2-8(6-11(10)19-13(16)17)12(14)9-7-18-5-4-15-9/h2-3,6,9,12,15H,4-5,7,14H2,1H3 |
| InChIKey | WEIYQOKJTAGYTM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |