C12H17F2N3 — CID 116941381
(2,5-difluorophenyl)-(4-methylpiperazin-2-yl)methanamine (PubChem CID 116941381) has the molecular formula C12H17F2N3 and a molecular weight of 241.28 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(4-methylpiperazin-2-yl)methanamine.
| Compound Name | (2,5-difluorophenyl)-(4-methylpiperazin-2-yl)methanamine |
|---|---|
| PubChem CID | 116941381 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | (2,5-difluorophenyl)-(4-methylpiperazin-2-yl)methanamine |
| SMILES | CN1CCNC(C(N)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C12H17F2N3/c1-17-5-4-16-11(7-17)12(15)9-6-8(13)2-3-10(9)14/h2-3,6,11-12,16H,4-5,7,15H2,1H3 |
| InChIKey | LTMFJVPAKGTBBA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |