C14H21N5 — CID 116941411
(2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-2-yl)methanamine (PubChem CID 116941411) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is (2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-2-yl)methanamine.
| Compound Name | (2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-2-yl)methanamine |
|---|---|
| PubChem CID | 116941411 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | (2-methyl-3H-benzimidazol-5-yl)-(4-methylpiperazin-2-yl)methanamine |
| SMILES | Cc1nc2ccc(C(N)C3CN(C)CCN3)cc2[nH]1 |
| InChI | InChI=1S/C14H21N5/c1-9-17-11-4-3-10(7-12(11)18-9)14(15)13-8-19(2)6-5-16-13/h3-4,7,13-14,16H,5-6,8,15H2,1-2H3,(H,17,18) |
| InChIKey | NKMDEHBCARSLEF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |