C12H18N2O2S — CID 116942259
2,3-diamino-3-(4-propan-2-ylsulfanylphenyl)propanoic acid (PubChem CID 116942259) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 2,3-diamino-3-(4-propan-2-ylsulfanylphenyl)propanoic acid.
| Compound Name | 2,3-diamino-3-(4-propan-2-ylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 116942259 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2,3-diamino-3-(4-propan-2-ylsulfanylphenyl)propanoic acid |
| SMILES | CC(C)Sc1ccc(C(N)C(N)C(=O)O)cc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-7(2)17-9-5-3-8(4-6-9)10(13)11(14)12(15)16/h3-7,10-11H,13-14H2,1-2H3,(H,15,16) |
| InChIKey | INXIQPSVKRWJOU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |