C14H19NO2S — CID 116943125
1-[amino-(4-propan-2-ylsulfanylphenyl)methyl]cyclopropane-1-carboxylic acid (PubChem CID 116943125) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 1-[amino-(4-propan-2-ylsulfanylphenyl)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[amino-(4-propan-2-ylsulfanylphenyl)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 116943125 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-[amino-(4-propan-2-ylsulfanylphenyl)methyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)Sc1ccc(C(N)C2(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C14H19NO2S/c1-9(2)18-11-5-3-10(4-6-11)12(15)14(7-8-14)13(16)17/h3-6,9,12H,7-8,15H2,1-2H3,(H,16,17) |
| InChIKey | XYXUAJXUSSKDNE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |