C11H14N2O2 — CID 84674164
1-[amino-(3-aminophenyl)methyl]cyclopropane-1-carboxylic acid (PubChem CID 84674164) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-[amino-(3-aminophenyl)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[amino-(3-aminophenyl)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 84674164 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-[amino-(3-aminophenyl)methyl]cyclopropane-1-carboxylic acid |
| SMILES | Nc1cccc(C(N)C2(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C11H14N2O2/c12-8-3-1-2-7(6-8)9(13)11(4-5-11)10(14)15/h1-3,6,9H,4-5,12-13H2,(H,14,15) |
| InChIKey | KVRMIKRHWFHMIG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|