C12H18N2 — CID 116943782
[1-(aminomethyl)cyclobutyl]-phenylmethanamine (PubChem CID 116943782) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is [1-(aminomethyl)cyclobutyl]-phenylmethanamine.
| Compound Name | [1-(aminomethyl)cyclobutyl]-phenylmethanamine |
|---|---|
| PubChem CID | 116943782 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | [1-(aminomethyl)cyclobutyl]-phenylmethanamine |
| SMILES | NCC1(C(N)c2ccccc2)CCC1 |
| InChI | InChI=1S/C12H18N2/c13-9-12(7-4-8-12)11(14)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,13-14H2 |
| InChIKey | JQXZELYGBJFURV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |