C11H19N3 — CID 116943976
[1-(methylaminomethyl)cyclobutyl]-(1H-pyrrol-3-yl)methanamine (PubChem CID 116943976) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is [1-(methylaminomethyl)cyclobutyl]-(1H-pyrrol-3-yl)methanamine.
| Compound Name | [1-(methylaminomethyl)cyclobutyl]-(1H-pyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 116943976 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | [1-(methylaminomethyl)cyclobutyl]-(1H-pyrrol-3-yl)methanamine |
| SMILES | CNCC1(C(N)c2cc[nH]c2)CCC1 |
| InChI | InChI=1S/C11H19N3/c1-13-8-11(4-2-5-11)10(12)9-3-6-14-7-9/h3,6-7,10,13-14H,2,4-5,8,12H2,1H3 |
| InChIKey | NCRVAAJQDVGLNB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |