C9H14N2O — CID 116943238
[1-[amino(1H-pyrrol-3-yl)methyl]cyclopropyl]methanol (PubChem CID 116943238) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is [1-[amino(1H-pyrrol-3-yl)methyl]cyclopropyl]methanol.
| Compound Name | [1-[amino(1H-pyrrol-3-yl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 116943238 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | [1-[amino(1H-pyrrol-3-yl)methyl]cyclopropyl]methanol |
| SMILES | NC(c1cc[nH]c1)C1(CO)CC1 |
| InChI | InChI=1S/C9H14N2O/c10-8(7-1-4-11-5-7)9(6-12)2-3-9/h1,4-5,8,11-12H,2-3,6,10H2 |
| InChIKey | PPOOMICTPMOCPQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |