C7H11NO2S — CID 170821259
1-(1H-pyrrol-3-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170821259) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is 1-(1H-pyrrol-3-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(1H-pyrrol-3-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821259 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 1-(1H-pyrrol-3-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1cc[nH]c1 |
| InChI | InChI=1S/C7H11NO2S/c9-6(4-11)7(10)5-1-2-8-3-5/h1-3,6-11H,4H2 |
| InChIKey | NFIDSOIVGGOOOD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|