C13H20N2O3 — CID 116944913
[3-(aminomethyl)oxetan-3-yl]-(2,5-dimethoxyphenyl)methanamine (PubChem CID 116944913) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is [3-(aminomethyl)oxetan-3-yl]-(2,5-dimethoxyphenyl)methanamine.
| Compound Name | [3-(aminomethyl)oxetan-3-yl]-(2,5-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 116944913 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [3-(aminomethyl)oxetan-3-yl]-(2,5-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(OC)c(C(N)C2(CN)COC2)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-16-9-3-4-11(17-2)10(5-9)12(15)13(6-14)7-18-8-13/h3-5,12H,6-8,14-15H2,1-2H3 |
| InChIKey | UNJDIWCCOXFAGI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |