C14H22FN3O — CID 116946740
1-(3-fluoro-4-methoxyphenyl)-2-piperazin-1-ylpropan-1-amine (PubChem CID 116946740) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-2-piperazin-1-ylpropan-1-amine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-2-piperazin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 116946740 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-2-piperazin-1-ylpropan-1-amine |
| SMILES | COc1ccc(C(N)C(C)N2CCNCC2)cc1F |
| InChI | InChI=1S/C14H22FN3O/c1-10(18-7-5-17-6-8-18)14(16)11-3-4-13(19-2)12(15)9-11/h3-4,9-10,14,17H,5-8,16H2,1-2H3 |
| InChIKey | NNVUJHUYWQSFAS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |