C13H22N2O — CID 116949687
1-(4-methoxyphenyl)-N,3-dimethylbutane-1,4-diamine (PubChem CID 116949687) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,3-dimethylbutane-1,4-diamine.
| Compound Name | 1-(4-methoxyphenyl)-N,3-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949687 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,3-dimethylbutane-1,4-diamine |
| SMILES | CNC(CC(C)CN)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-10(9-14)8-13(15-2)11-4-6-12(16-3)7-5-11/h4-7,10,13,15H,8-9,14H2,1-3H3 |
| InChIKey | SSXGKBOVDXVOMM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |