C12H20N2O — CID 116949257
1-(4-methoxyphenyl)-N-methylbutane-1,4-diamine (PubChem CID 116949257) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-methylbutane-1,4-diamine.
| Compound Name | 1-(4-methoxyphenyl)-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949257 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-methylbutane-1,4-diamine |
| SMILES | CNC(CCCN)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H20N2O/c1-14-12(4-3-9-13)10-5-7-11(15-2)8-6-10/h5-8,12,14H,3-4,9,13H2,1-2H3 |
| InChIKey | DJQXDQQIGTTYJK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |