C14H24N2S — CID 116949337
N-methyl-1-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine (PubChem CID 116949337) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N-methyl-1-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine.
| Compound Name | N-methyl-1-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116949337 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-methyl-1-(4-propan-2-ylsulfanylphenyl)butane-1,4-diamine |
| SMILES | CNC(CCCN)c1ccc(SC(C)C)cc1 |
| InChI | InChI=1S/C14H24N2S/c1-11(2)17-13-8-6-12(7-9-13)14(16-3)5-4-10-15/h6-9,11,14,16H,4-5,10,15H2,1-3H3 |
| InChIKey | HVHBMZVAKXGHEN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |