C15H23FN2O — CID 116951797
1-(3-fluoro-4-methoxyphenyl)-N-methyl-2-piperidin-4-ylethanamine (PubChem CID 116951797) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-N-methyl-2-piperidin-4-ylethanamine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-N-methyl-2-piperidin-4-ylethanamine |
|---|---|
| PubChem CID | 116951797 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-N-methyl-2-piperidin-4-ylethanamine |
| SMILES | CNC(CC1CCNCC1)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H23FN2O/c1-17-14(9-11-5-7-18-8-6-11)12-3-4-15(19-2)13(16)10-12/h3-4,10-11,14,17-18H,5-9H2,1-2H3 |
| InChIKey | YTRYAAIZOKAZQX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |