C17H21NO — CID 116952947
4-(methylamino)-4-(4-phenylphenyl)butan-1-ol (PubChem CID 116952947) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-(methylamino)-4-(4-phenylphenyl)butan-1-ol.
| Compound Name | 4-(methylamino)-4-(4-phenylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 116952947 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-(methylamino)-4-(4-phenylphenyl)butan-1-ol |
| SMILES | CNC(CCCO)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO/c1-18-17(8-5-13-19)16-11-9-15(10-12-16)14-6-3-2-4-7-14/h2-4,6-7,9-12,17-19H,5,8,13H2,1H3 |
| InChIKey | NCOXEWQUAGUTTF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |