C15H23N — CID 66037848
N-methyl-5-methylidene-1-phenylheptan-1-amine (PubChem CID 66037848) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-methyl-5-methylidene-1-phenylheptan-1-amine.
| Compound Name | N-methyl-5-methylidene-1-phenylheptan-1-amine |
|---|---|
| PubChem CID | 66037848 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-methyl-5-methylidene-1-phenylheptan-1-amine |
| SMILES | C=C(CC)CCCC(NC)c1ccccc1 |
| InChI | InChI=1S/C15H23N/c1-4-13(2)9-8-12-15(16-3)14-10-6-5-7-11-14/h5-7,10-11,15-16H,2,4,8-9,12H2,1,3H3 |
| InChIKey | TXPXCSOIGFSEGM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|