C12H17ClFN3 — CID 116954827
1-(3-chloro-4-fluorophenyl)-N-methyl-1-piperazin-1-ylmethanamine (PubChem CID 116954827) has the molecular formula C12H17ClFN3 and a molecular weight of 257.74 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-methyl-1-piperazin-1-ylmethanamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-piperazin-1-ylmethanamine |
|---|---|
| PubChem CID | 116954827 |
| Molecular Formula | C12H17ClFN3 |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-piperazin-1-ylmethanamine |
| SMILES | CNC(c1ccc(F)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H17ClFN3/c1-15-12(17-6-4-16-5-7-17)9-2-3-11(14)10(13)8-9/h2-3,8,12,15-16H,4-7H2,1H3 |
| InChIKey | WPSQURGLZKAUNO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |