C21H21NO3 — CID 11695711
methyl (2R,5E)-1-benzyl-5-phenacylidenepyrrolidine-2-carboxylate (PubChem CID 11695711) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl (2R,5E)-1-benzyl-5-phenacylidenepyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,5E)-1-benzyl-5-phenacylidenepyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11695711 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl (2R,5E)-1-benzyl-5-phenacylidenepyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC/C(=C\C(=O)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c1-25-21(24)19-13-12-18(14-20(23)17-10-6-3-7-11-17)22(19)15-16-8-4-2-5-9-16/h2-11,14,19H,12-13,15H2,1H3/b18-14+/t19-/m1/s1 |
| InChIKey | FRHIPTINKBPRKO-YWXUCKCNSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|