C10H16N2O2 — CID 116959709
2-[methylamino(1H-pyrrol-3-yl)methyl]butanoic acid (PubChem CID 116959709) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[methylamino(1H-pyrrol-3-yl)methyl]butanoic acid.
| Compound Name | 2-[methylamino(1H-pyrrol-3-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 116959709 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-[methylamino(1H-pyrrol-3-yl)methyl]butanoic acid |
| SMILES | CCC(C(=O)O)C(NC)c1cc[nH]c1 |
| InChI | InChI=1S/C10H16N2O2/c1-3-8(10(13)14)9(11-2)7-4-5-12-6-7/h4-6,8-9,11-12H,3H2,1-2H3,(H,13,14) |
| InChIKey | VOFHDJDOHUYNDW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |