C12H15BrFNO2 — CID 116959731
2-[(5-bromo-2-fluorophenyl)-(methylamino)methyl]butanoic acid (PubChem CID 116959731) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)-(methylamino)methyl]butanoic acid.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)-(methylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 116959731 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)-(methylamino)methyl]butanoic acid |
| SMILES | CCC(C(=O)O)C(NC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFNO2/c1-3-8(12(16)17)11(15-2)9-6-7(13)4-5-10(9)14/h4-6,8,11,15H,3H2,1-2H3,(H,16,17) |
| InChIKey | INGDTNMENSKXLO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |