C13H18FNO2 — CID 116959808
2-[(2-fluorophenyl)-(methylamino)methyl]-3-methylbutanoic acid (PubChem CID 116959808) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)-(methylamino)methyl]-3-methylbutanoic acid.
| Compound Name | 2-[(2-fluorophenyl)-(methylamino)methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 116959808 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[(2-fluorophenyl)-(methylamino)methyl]-3-methylbutanoic acid |
| SMILES | CNC(c1ccccc1F)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H18FNO2/c1-8(2)11(13(16)17)12(15-3)9-6-4-5-7-10(9)14/h4-8,11-12,15H,1-3H3,(H,16,17) |
| InChIKey | LIKOWTNAPPPKIP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |