C9H13BrN2S — CID 116961189
1-[(5-bromothiophen-2-yl)-(methylamino)methyl]cyclopropan-1-amine (PubChem CID 116961189) has the molecular formula C9H13BrN2S and a molecular weight of 261.19 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(methylamino)methyl]cyclopropan-1-amine.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(methylamino)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 116961189 |
| Molecular Formula | C9H13BrN2S |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(methylamino)methyl]cyclopropan-1-amine |
| SMILES | CNC(c1ccc(Br)s1)C1(N)CC1 |
| InChI | InChI=1S/C9H13BrN2S/c1-12-8(9(11)4-5-9)6-2-3-7(10)13-6/h2-3,8,12H,4-5,11H2,1H3 |
| InChIKey | MRKGJTADGPISMU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |