C10H15BrN2S — CID 116943526
(5-bromothiophen-2-yl)-[1-(methylaminomethyl)cyclopropyl]methanamine (PubChem CID 116943526) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-[1-(methylaminomethyl)cyclopropyl]methanamine.
| Compound Name | (5-bromothiophen-2-yl)-[1-(methylaminomethyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 116943526 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (5-bromothiophen-2-yl)-[1-(methylaminomethyl)cyclopropyl]methanamine |
| SMILES | CNCC1(C(N)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C10H15BrN2S/c1-13-6-10(4-5-10)9(12)7-2-3-8(11)14-7/h2-3,9,13H,4-6,12H2,1H3 |
| InChIKey | WHPKIMOATGSTER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |