C13H17BrO — CID 116963289
4-(5-bromo-2-methylphenyl)cyclohexan-1-ol (PubChem CID 116963289) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 4-(5-bromo-2-methylphenyl)cyclohexan-1-ol.
| Compound Name | 4-(5-bromo-2-methylphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 116963289 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-(5-bromo-2-methylphenyl)cyclohexan-1-ol |
| SMILES | Cc1ccc(Br)cc1C1CCC(O)CC1 |
| InChI | InChI=1S/C13H17BrO/c1-9-2-5-11(14)8-13(9)10-3-6-12(15)7-4-10/h2,5,8,10,12,15H,3-4,6-7H2,1H3 |
| InChIKey | VIVLGUDICWCHAK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |