C14H21N3 — CID 116964360
N,3-dimethyl-2-(1-methylbenzimidazol-5-yl)butan-1-amine (PubChem CID 116964360) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N,3-dimethyl-2-(1-methylbenzimidazol-5-yl)butan-1-amine.
| Compound Name | N,3-dimethyl-2-(1-methylbenzimidazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 116964360 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N,3-dimethyl-2-(1-methylbenzimidazol-5-yl)butan-1-amine |
| SMILES | CNCC(c1ccc2c(c1)ncn2C)C(C)C |
| InChI | InChI=1S/C14H21N3/c1-10(2)12(8-15-3)11-5-6-14-13(7-11)16-9-17(14)4/h5-7,9-10,12,15H,8H2,1-4H3 |
| InChIKey | WCQOSDUAOAHBLW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |