C15H22O4 — CID 116964458
methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate (PubChem CID 116964458) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate.
| Compound Name | methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate |
|---|---|
| PubChem CID | 116964458 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate |
| SMILES | CCC(C(=O)OC)c1cc(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C15H22O4/c1-7-11(15(16)19-6)12-8-13(17-4)9(2)10(3)14(12)18-5/h8,11H,7H2,1-6H3 |
| InChIKey | PLXWRLICPHRDEQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |