methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate

C15H22O4 — CID 116964458

IUPACmethyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate
SMILESCCC(C(=O)OC)c1cc(OC)c(C)c(C)c1OC
InChIInChI=1S/C15H22O4/c1-7-11(15(16)19-6)12-8-13(17-4)9(2)10(3)14(12)18-5/h8,11H,7H2,1-6H3
InChIKeyPLXWRLICPHRDEQ-UHFFFAOYSA-N
MW266.34 g/mol
LogP2.99
Rot. Bonds5

About methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate

methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate (PubChem CID 116964458) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate.

Molecular Properties

Compound Namemethyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate
PubChem CID116964458
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Namemethyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate
SMILESCCC(C(=O)OC)c1cc(OC)c(C)c(C)c1OC
InChIInChI=1S/C15H22O4/c1-7-11(15(16)19-6)12-8-13(17-4)9(2)10(3)14(12)18-5/h8,11H,7H2,1-6H3
InChIKeyPLXWRLICPHRDEQ-UHFFFAOYSA-N
XLogP2.99
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 52.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate?
The IUPAC name of methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate (CID 116964458) is methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate.
What is the SMILES notation for methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate?
The canonical SMILES for methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate is CCC(C(=O)OC)c1cc(OC)c(C)c(C)c1OC.
What is the InChIKey of methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate?
The InChIKey is PLXWRLICPHRDEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-7-11(15(16)19-6)12-8-13(17-4)9(2)10(3)14(12)18-5/h8,11H,7H2,1-6H3.
What are the key properties of methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate?
methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate has a molecular weight of 266.34 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)butanoate is sourced from PubChem (CID 116964458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).