C13H12BrNO2S — CID 116966426
1-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-one (PubChem CID 116966426) has the molecular formula C13H12BrNO2S and a molecular weight of 326.22 g/mol. Its IUPAC name is 1-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-one.
| Compound Name | 1-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-one |
|---|---|
| PubChem CID | 116966426 |
| Molecular Formula | C13H12BrNO2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 1-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]propan-2-one |
| SMILES | COc1ccc(-c2csc(CC(C)=O)n2)cc1Br |
| InChI | InChI=1S/C13H12BrNO2S/c1-8(16)5-13-15-11(7-18-13)9-3-4-12(17-2)10(14)6-9/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | OOOPXCHZJXGZTI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |