C24H28N6O4S — CID 1169674
N'-[2-[(4-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3,4-dimethoxybenzohydrazide (PubChem CID 1169674) has the molecular formula C24H28N6O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is N'-[2-[(4-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-[(4-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 1169674 |
| Molecular Formula | C24H28N6O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N'-[2-[(4-cyclohexyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CSc2nnc(-c3ccncc3)n2C2CCCCC2)cc1OC |
| InChI | InChI=1S/C24H28N6O4S/c1-33-19-9-8-17(14-20(19)34-2)23(32)28-26-21(31)15-35-24-29-27-22(16-10-12-25-13-11-16)30(24)18-6-4-3-5-7-18/h8-14,18H,3-7,15H2,1-2H3,(H,26,31)(H,28,32) |
| InChIKey | XGPKONJZGSXUKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|