C12H9BrN2O2S — CID 116968053
6-(2-bromo-1,3-thiazol-4-yl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 116968053) has the molecular formula C12H9BrN2O2S and a molecular weight of 325.19 g/mol. Its IUPAC name is 6-(2-bromo-1,3-thiazol-4-yl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-bromo-1,3-thiazol-4-yl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116968053 |
| Molecular Formula | C12H9BrN2O2S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 6-(2-bromo-1,3-thiazol-4-yl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(-c3csc(Br)n3)cc2NC1=O |
| InChI | InChI=1S/C12H9BrN2O2S/c1-6-11(16)14-8-4-7(2-3-10(8)17-6)9-5-18-12(13)15-9/h2-6H,1H3,(H,14,16) |
| InChIKey | GENSDWXFWQBREY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |