C22H22ClNO2 — CID 11697064
[1-(4-chlorophenyl)-3-(dimethylamino)propyl] naphthalene-2-carboxylate (PubChem CID 11697064) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-(dimethylamino)propyl] naphthalene-2-carboxylate.
| Compound Name | [1-(4-chlorophenyl)-3-(dimethylamino)propyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11697064 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [1-(4-chlorophenyl)-3-(dimethylamino)propyl] naphthalene-2-carboxylate |
| SMILES | CN(C)CCC(OC(=O)c1ccc2ccccc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO2/c1-24(2)14-13-21(17-9-11-20(23)12-10-17)26-22(25)19-8-7-16-5-3-4-6-18(16)15-19/h3-12,15,21H,13-14H2,1-2H3 |
| InChIKey | NHZQSQXKZNYYSW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |