C13H22N4 — CID 116970742
N'-(6-cyclopentylpyridazin-3-yl)-N-methylpropane-1,3-diamine (PubChem CID 116970742) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N'-(6-cyclopentylpyridazin-3-yl)-N-methylpropane-1,3-diamine.
| Compound Name | N'-(6-cyclopentylpyridazin-3-yl)-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116970742 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N'-(6-cyclopentylpyridazin-3-yl)-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1ccc(C2CCCC2)nn1 |
| InChI | InChI=1S/C13H22N4/c1-14-9-4-10-15-13-8-7-12(16-17-13)11-5-2-3-6-11/h7-8,11,14H,2-6,9-10H2,1H3,(H,15,17) |
| InChIKey | JZGYDKKFJDLVAM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|