C12H20N4 — CID 116973215
N-ethyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine (PubChem CID 116973215) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N-ethyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine.
| Compound Name | N-ethyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 116973215 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-ethyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine |
| SMILES | CCNc1ccc(C2CCN(C)CC2)nn1 |
| InChI | InChI=1S/C12H20N4/c1-3-13-12-5-4-11(14-15-12)10-6-8-16(2)9-7-10/h4-5,10H,3,6-9H2,1-2H3,(H,13,15) |
| InChIKey | VWNRSJIHTBOTGH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |