C11H18N4 — CID 116973161
N-methyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine (PubChem CID 116973161) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is N-methyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine.
| Compound Name | N-methyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 116973161 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-methyl-6-(1-methylpiperidin-4-yl)pyridazin-3-amine |
| SMILES | CNc1ccc(C2CCN(C)CC2)nn1 |
| InChI | InChI=1S/C11H18N4/c1-12-11-4-3-10(13-14-11)9-5-7-15(2)8-6-9/h3-4,9H,5-8H2,1-2H3,(H,12,14) |
| InChIKey | YAYXBKKCZSCHSZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |