C12H15N5 — CID 116970983
N-pyrrolidin-3-yl-6-(1H-pyrrol-3-yl)pyridazin-3-amine (PubChem CID 116970983) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-6-(1H-pyrrol-3-yl)pyridazin-3-amine.
| Compound Name | N-pyrrolidin-3-yl-6-(1H-pyrrol-3-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 116970983 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-pyrrolidin-3-yl-6-(1H-pyrrol-3-yl)pyridazin-3-amine |
| SMILES | c1cc(-c2ccc(NC3CCNC3)nn2)c[nH]1 |
| InChI | InChI=1S/C12H15N5/c1-2-12(15-10-4-6-14-8-10)17-16-11(1)9-3-5-13-7-9/h1-3,5,7,10,13-14H,4,6,8H2,(H,15,17) |
| InChIKey | BFYVYILQOJOCJZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |