C9H15ClN4 — CID 71638623
6-methyl-N-[(3R)-pyrrolidin-3-yl]pyridazin-3-amine;hydrochloride (PubChem CID 71638623) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is 6-methyl-N-[(3R)-pyrrolidin-3-yl]pyridazin-3-amine;hydrochloride.
| Compound Name | 6-methyl-N-[(3R)-pyrrolidin-3-yl]pyridazin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71638623 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6-methyl-N-[(3R)-pyrrolidin-3-yl]pyridazin-3-amine;hydrochloride |
| SMILES | Cc1ccc(N[C@@H]2CCNC2)nn1.Cl |
| InChI | InChI=1S/C9H14N4.ClH/c1-7-2-3-9(13-12-7)11-8-4-5-10-6-8;/h2-3,8,10H,4-6H2,1H3,(H,11,13);1H/t8-;/m1./s1 |
| InChIKey | FSOPYOYYHGWSHV-DDWIOCJRSA-N |
| XLogP | 0.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |