C13H16N4S — CID 116973478
N-methyl-N-pyrrolidin-3-yl-6-thiophen-2-ylpyridazin-3-amine (PubChem CID 116973478) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is N-methyl-N-pyrrolidin-3-yl-6-thiophen-2-ylpyridazin-3-amine.
| Compound Name | N-methyl-N-pyrrolidin-3-yl-6-thiophen-2-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 116973478 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-methyl-N-pyrrolidin-3-yl-6-thiophen-2-ylpyridazin-3-amine |
| SMILES | CN(c1ccc(-c2cccs2)nn1)C1CCNC1 |
| InChI | InChI=1S/C13H16N4S/c1-17(10-6-7-14-9-10)13-5-4-11(15-16-13)12-3-2-8-18-12/h2-5,8,10,14H,6-7,9H2,1H3 |
| InChIKey | BXAWOMMIAPYOEA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |