C13H18N4S — CID 116973440
N,N'-dimethyl-N'-(6-thiophen-2-ylpyridazin-3-yl)propane-1,3-diamine (PubChem CID 116973440) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(6-thiophen-2-ylpyridazin-3-yl)propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-N'-(6-thiophen-2-ylpyridazin-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116973440 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N,N'-dimethyl-N'-(6-thiophen-2-ylpyridazin-3-yl)propane-1,3-diamine |
| SMILES | CNCCCN(C)c1ccc(-c2cccs2)nn1 |
| InChI | InChI=1S/C13H18N4S/c1-14-8-4-9-17(2)13-7-6-11(15-16-13)12-5-3-10-18-12/h3,5-7,10,14H,4,8-9H2,1-2H3 |
| InChIKey | WWGJKQOTRXHKLO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|