C13H17N5O — CID 116976011
N-(morpholin-3-ylmethyl)-5-(1H-pyrrol-3-yl)pyrimidin-2-amine (PubChem CID 116976011) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(morpholin-3-ylmethyl)-5-(1H-pyrrol-3-yl)pyrimidin-2-amine.
| Compound Name | N-(morpholin-3-ylmethyl)-5-(1H-pyrrol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 116976011 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(morpholin-3-ylmethyl)-5-(1H-pyrrol-3-yl)pyrimidin-2-amine |
| SMILES | c1cc(-c2cnc(NCC3COCCN3)nc2)c[nH]1 |
| InChI | InChI=1S/C13H17N5O/c1-2-14-5-10(1)11-6-16-13(17-7-11)18-8-12-9-19-4-3-15-12/h1-2,5-7,12,14-15H,3-4,8-9H2,(H,16,17,18) |
| InChIKey | XOXXQEQCZRAJJY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |