C13H15BrN4O — CID 103549139
7-bromo-N-(morpholin-3-ylmethyl)-1,5-naphthyridin-4-amine (PubChem CID 103549139) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 7-bromo-N-(morpholin-3-ylmethyl)-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-(morpholin-3-ylmethyl)-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 103549139 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 7-bromo-N-(morpholin-3-ylmethyl)-1,5-naphthyridin-4-amine |
| SMILES | Brc1cnc2c(NCC3COCCN3)ccnc2c1 |
| InChI | InChI=1S/C13H15BrN4O/c14-9-5-12-13(18-6-9)11(1-2-16-12)17-7-10-8-19-4-3-15-10/h1-2,5-6,10,15H,3-4,7-8H2,(H,16,17) |
| InChIKey | RGHZGMHWBXPOFC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |